C22H30ClN5O2S — CID 144675949
2-chloro-5-methanimidoyl-1-N-(7-methoxy-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine;ethane;methoxymethane (PubChem CID 144675949) has the molecular formula C22H30ClN5O2S and a molecular weight of 464.04 g/mol. Its IUPAC name is 2-chloro-5-methanimidoyl-1-N-(7-methoxy-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine;ethane;methoxymethane.
| Compound Name | 2-chloro-5-methanimidoyl-1-N-(7-methoxy-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine;ethane;methoxymethane |
|---|---|
| PubChem CID | 144675949 |
| Molecular Formula | C22H30ClN5O2S |
| Molecular Weight | 464.04 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 2-chloro-5-methanimidoyl-1-N-(7-methoxy-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine;ethane;methoxymethane |
| SMILES | CC.COC.[H]/N=C/c1cc(Nc2ncnc3sc4c(c23)CCC(OC)C4)c(Cl)cc1N |
| InChI | InChI=1S/C18H18ClN5OS.C2H6O.C2H6/c1-25-10-2-3-11-15(5-10)26-18-16(11)17(22-8-23-18)24-14-4-9(7-20)13(21)6-12(14)19;1-3-2;1-2/h4,6-8,10,20H,2-3,5,21H2,1H3,(H,22,23,24);1-2H3;1-2H3/b20-7+;; |
| InChIKey | FOJREQCKISMSFO-JJDNOXQCSA-N |
| XLogP | 5.46 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.04 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|