C22H26N6O2S — CID 123988050
4-[[4-(4-amino-5-methanimidoyl-2-methoxyanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]amino]butan-2-one (PubChem CID 123988050) has the molecular formula C22H26N6O2S and a molecular weight of 438.56 g/mol. Its IUPAC name is 4-[[4-(4-amino-5-methanimidoyl-2-methoxyanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]amino]butan-2-one.
| Compound Name | 4-[[4-(4-amino-5-methanimidoyl-2-methoxyanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]amino]butan-2-one |
|---|---|
| PubChem CID | 123988050 |
| Molecular Formula | C22H26N6O2S |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 4-[[4-(4-amino-5-methanimidoyl-2-methoxyanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]amino]butan-2-one |
| SMILES | [H]/N=C/c1cc(Nc2ncnc3sc4c(c23)CCC(NCCC(C)=O)C4)c(OC)cc1N |
| InChI | InChI=1S/C22H26N6O2S/c1-12(29)5-6-25-14-3-4-15-19(8-14)31-22-20(15)21(26-11-27-22)28-17-7-13(10-23)16(24)9-18(17)30-2/h7,9-11,14,23,25H,3-6,8,24H2,1-2H3,(H,26,27,28)/b23-10+ |
| InChIKey | OUULCJYOOCBQLR-AUEPDCJTSA-N |
| XLogP | 3.45 |
| TPSA | 126.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|