C24H29FN6O2S — CID 144847477
2,6-dimethylmorpholine-4-carbaldehyde;2-fluoro-5-methanimidoyl-1-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine (PubChem CID 144847477) has the molecular formula C24H29FN6O2S and a molecular weight of 484.60 g/mol. Its IUPAC name is 2,6-dimethylmorpholine-4-carbaldehyde;2-fluoro-5-methanimidoyl-1-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine.
| Compound Name | 2,6-dimethylmorpholine-4-carbaldehyde;2-fluoro-5-methanimidoyl-1-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 144847477 |
| Molecular Formula | C24H29FN6O2S |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 2,6-dimethylmorpholine-4-carbaldehyde;2-fluoro-5-methanimidoyl-1-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzene-1,4-diamine |
| SMILES | CC1CN(C=O)CC(C)O1.[H]/N=C/c1cc(Nc2ncnc3sc4c(c23)CCCC4)c(F)cc1N |
| InChI | InChI=1S/C17H16FN5S.C7H13NO2/c18-11-6-12(20)9(7-19)5-13(11)23-16-15-10-3-1-2-4-14(10)24-17(15)22-8-21-16;1-6-3-8(5-9)4-7(2)10-6/h5-8,19H,1-4,20H2,(H,21,22,23);5-7H,3-4H2,1-2H3/b19-7+; |
| InChIKey | IHLFBKZSBPIGOI-YRQQTYEQSA-N |
| XLogP | 4.28 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|