C22H25N3O2S — CID 123356530
ethyl 2-[4-(3,4-dimethylanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]acetate (PubChem CID 123356530) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is ethyl 2-[4-(3,4-dimethylanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]acetate.
| Compound Name | ethyl 2-[4-(3,4-dimethylanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]acetate |
|---|---|
| PubChem CID | 123356530 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | ethyl 2-[4-(3,4-dimethylanilino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]acetate |
| SMILES | CCOC(=O)CC1CCc2c(sc3ncnc(Nc4ccc(C)c(C)c4)c23)C1 |
| InChI | InChI=1S/C22H25N3O2S/c1-4-27-19(26)11-15-6-8-17-18(10-15)28-22-20(17)21(23-12-24-22)25-16-7-5-13(2)14(3)9-16/h5,7,9,12,15H,4,6,8,10-11H2,1-3H3,(H,23,24,25) |
| InChIKey | SIMBDFPGVSHADG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |