C19H18N4O2S2 — CID 118554301
ethyl (7S)-4-(7-thia-8-azabicyclo[4.2.0]octa-1(6),2,4-trien-4-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylate (PubChem CID 118554301) has the molecular formula C19H18N4O2S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is ethyl (7S)-4-(7-thia-8-azabicyclo[4.2.0]octa-1(6),2,4-trien-4-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylate.
| Compound Name | ethyl (7S)-4-(7-thia-8-azabicyclo[4.2.0]octa-1(6),2,4-trien-4-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 118554301 |
| Molecular Formula | C19H18N4O2S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | ethyl (7S)-4-(7-thia-8-azabicyclo[4.2.0]octa-1(6),2,4-trien-4-ylamino)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCc2c(sc3ncnc(Nc4ccc5[nH]sc5c4)c23)C1 |
| InChI | InChI=1S/C19H18N4O2S2/c1-2-25-19(24)10-3-5-12-14(7-10)26-18-16(12)17(20-9-21-18)22-11-4-6-13-15(8-11)27-23-13/h4,6,8-10,23H,2-3,5,7H2,1H3,(H,20,21,22)/t10-/m0/s1 |
| InChIKey | LBRJGOGSKRNTDV-JTQLQIEISA-N |
| XLogP | 4.65 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |