C11H9ClFN5 — CID 144828615
4-N-(2-chloro-5-fluoropyrimidin-4-yl)-2-methanimidoylbenzene-1,4-diamine (PubChem CID 144828615) has the molecular formula C11H9ClFN5 and a molecular weight of 265.68 g/mol. Its IUPAC name is 4-N-(2-chloro-5-fluoropyrimidin-4-yl)-2-methanimidoylbenzene-1,4-diamine.
| Compound Name | 4-N-(2-chloro-5-fluoropyrimidin-4-yl)-2-methanimidoylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 144828615 |
| Molecular Formula | C11H9ClFN5 |
| Molecular Weight | 265.68 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 4-N-(2-chloro-5-fluoropyrimidin-4-yl)-2-methanimidoylbenzene-1,4-diamine |
| SMILES | [H]/N=C/c1cc(Nc2nc(Cl)ncc2F)ccc1N |
| InChI | InChI=1S/C11H9ClFN5/c12-11-16-5-8(13)10(18-11)17-7-1-2-9(15)6(3-7)4-14/h1-5,14H,15H2,(H,16,17,18)/b14-4+ |
| InChIKey | YPXVVXOELCUNLT-LNKIKWGQSA-N |
| XLogP | 2.59 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.68 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|