C12H6ClFN4O2 — CID 79081237
5-[(2-chloro-5-fluoropyrimidin-4-yl)amino]isoindole-1,3-dione (PubChem CID 79081237) has the molecular formula C12H6ClFN4O2 and a molecular weight of 292.66 g/mol. Its IUPAC name is 5-[(2-chloro-5-fluoropyrimidin-4-yl)amino]isoindole-1,3-dione.
| Compound Name | 5-[(2-chloro-5-fluoropyrimidin-4-yl)amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 79081237 |
| Molecular Formula | C12H6ClFN4O2 |
| Molecular Weight | 292.66 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 5-[(2-chloro-5-fluoropyrimidin-4-yl)amino]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(Nc3nc(Cl)ncc3F)ccc21 |
| InChI | InChI=1S/C12H6ClFN4O2/c13-12-15-4-8(14)9(17-12)16-5-1-2-6-7(3-5)11(20)18-10(6)19/h1-4H,(H,15,16,17)(H,18,19,20) |
| InChIKey | YMGFFWUZPSCIOP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.66 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|