C13H9ClN4O2 — CID 62476432
5-[(2-chloro-6-methylpyrimidin-4-yl)amino]isoindole-1,3-dione (PubChem CID 62476432) has the molecular formula C13H9ClN4O2 and a molecular weight of 288.69 g/mol. Its IUPAC name is 5-[(2-chloro-6-methylpyrimidin-4-yl)amino]isoindole-1,3-dione.
| Compound Name | 5-[(2-chloro-6-methylpyrimidin-4-yl)amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 62476432 |
| Molecular Formula | C13H9ClN4O2 |
| Molecular Weight | 288.69 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 5-[(2-chloro-6-methylpyrimidin-4-yl)amino]isoindole-1,3-dione |
| SMILES | Cc1cc(Nc2ccc3c(c2)C(=O)NC3=O)nc(Cl)n1 |
| InChI | InChI=1S/C13H9ClN4O2/c1-6-4-10(17-13(14)15-6)16-7-2-3-8-9(5-7)12(20)18-11(8)19/h2-5H,1H3,(H,15,16,17)(H,18,19,20) |
| InChIKey | XWYYWXVLBQRNQD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.69 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|