C14H10BrN3O2 — CID 106876452
5-[(3-bromo-4-methyl-2-pyridinyl)amino]isoindole-1,3-dione (PubChem CID 106876452) has the molecular formula C14H10BrN3O2 and a molecular weight of 332.16 g/mol. Its IUPAC name is 5-[(3-bromo-4-methyl-2-pyridinyl)amino]isoindole-1,3-dione.
| Compound Name | 5-[(3-bromo-4-methyl-2-pyridinyl)amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 106876452 |
| Molecular Formula | C14H10BrN3O2 |
| Molecular Weight | 332.16 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 5-[(3-bromo-4-methyl-2-pyridinyl)amino]isoindole-1,3-dione |
| SMILES | Cc1ccnc(Nc2ccc3c(c2)C(=O)NC3=O)c1Br |
| InChI | InChI=1S/C14H10BrN3O2/c1-7-4-5-16-12(11(7)15)17-8-2-3-9-10(6-8)14(20)18-13(9)19/h2-6H,1H3,(H,16,17)(H,18,19,20) |
| InChIKey | CDKPWLFBAQHNGP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.16 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|