C11H6BrN3O2S — CID 79400610
5-[(4-bromo-1,3-thiazol-2-yl)amino]isoindole-1,3-dione (PubChem CID 79400610) has the molecular formula C11H6BrN3O2S and a molecular weight of 324.16 g/mol. Its IUPAC name is 5-[(4-bromo-1,3-thiazol-2-yl)amino]isoindole-1,3-dione.
| Compound Name | 5-[(4-bromo-1,3-thiazol-2-yl)amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 79400610 |
| Molecular Formula | C11H6BrN3O2S |
| Molecular Weight | 324.16 g/mol |
| Exact Mass | 322.94 |
| IUPAC Name | 5-[(4-bromo-1,3-thiazol-2-yl)amino]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(Nc3nc(Br)cs3)ccc21 |
| InChI | InChI=1S/C11H6BrN3O2S/c12-8-4-18-11(14-8)13-5-1-2-6-7(3-5)10(17)15-9(6)16/h1-4H,(H,13,14)(H,15,16,17) |
| InChIKey | LMEPSCPOSWKTHX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.16 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|