4-[(4-bromo-1,3-thiazol-2-yl)amino]-2-methylbenzoic acid

C11H9BrN2O2S — CID 79398841

IUPAC4-[(4-bromo-1,3-thiazol-2-yl)amino]-2-methylbenzoic acid
SMILESCc1cc(Nc2nc(Br)cs2)ccc1C(=O)O
InChIInChI=1S/C11H9BrN2O2S/c1-6-4-7(2-3-8(6)10(15)16)13-11-14-9(12)5-17-11/h2-5H,1H3,(H,13,14)(H,15,16)
InChIKeyYDUNPDYCEZHYEY-UHFFFAOYSA-N
MW313.18 g/mol
LogP3.66
Rot. Bonds3

About 4-[(4-bromo-1,3-thiazol-2-yl)amino]-2-methylbenzoic acid

4-[(4-bromo-1,3-thiazol-2-yl)amino]-2-methylbenzoic acid (PubChem CID 79398841) has the molecular formula C11H9BrN2O2S and a molecular weight of 313.18 g/mol. Its IUPAC name is 4-[(4-bromo-1,3-thiazol-2-yl)amino]-2-methylbenzoic acid.

Molecular Properties

Compound Name4-[(4-bromo-1,3-thiazol-2-yl)amino]-2-methylbenzoic acid
PubChem CID79398841
Molecular FormulaC11H9BrN2O2S
Molecular Weight313.18 g/mol
Exact Mass311.96
IUPAC Name4-[(4-bromo-1,3-thiazol-2-yl)amino]-2-methylbenzoic acid
SMILESCc1cc(Nc2nc(Br)cs2)ccc1C(=O)O
InChIInChI=1S/C11H9BrN2O2S/c1-6-4-7(2-3-8(6)10(15)16)13-11-14-9(12)5-17-11/h2-5H,1H3,(H,13,14)(H,15,16)
InChIKeyYDUNPDYCEZHYEY-UHFFFAOYSA-N
XLogP3.66
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.18
LogP ≤ 53.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-[(4-bromo-1,3-thiazol-2-yl)amino]-2-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(4-bromo-1,3-thiazol-2-yl)amino]-2-methylbenzoic acid?
The IUPAC name of 4-[(4-bromo-1,3-thiazol-2-yl)amino]-2-methylbenzoic acid (CID 79398841) is 4-[(4-bromo-1,3-thiazol-2-yl)amino]-2-methylbenzoic acid.
What is the SMILES notation for 4-[(4-bromo-1,3-thiazol-2-yl)amino]-2-methylbenzoic acid?
The canonical SMILES for 4-[(4-bromo-1,3-thiazol-2-yl)amino]-2-methylbenzoic acid is Cc1cc(Nc2nc(Br)cs2)ccc1C(=O)O.
What is the InChIKey of 4-[(4-bromo-1,3-thiazol-2-yl)amino]-2-methylbenzoic acid?
The InChIKey is YDUNPDYCEZHYEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrN2O2S/c1-6-4-7(2-3-8(6)10(15)16)13-11-14-9(12)5-17-11/h2-5H,1H3,(H,13,14)(H,15,16).
What are the key properties of 4-[(4-bromo-1,3-thiazol-2-yl)amino]-2-methylbenzoic acid?
4-[(4-bromo-1,3-thiazol-2-yl)amino]-2-methylbenzoic acid has a molecular weight of 313.18 g/mol, XLogP of 3.66, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-bromo-1,3-thiazol-2-yl)amino]-2-methylbenzoic acid is sourced from PubChem (CID 79398841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).