C12H9BrCl2N2 — CID 106876466
3-bromo-N-(3,5-dichlorophenyl)-4-methylpyridin-2-amine (PubChem CID 106876466) has the molecular formula C12H9BrCl2N2 and a molecular weight of 332.03 g/mol. Its IUPAC name is 3-bromo-N-(3,5-dichlorophenyl)-4-methylpyridin-2-amine.
| Compound Name | 3-bromo-N-(3,5-dichlorophenyl)-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 106876466 |
| Molecular Formula | C12H9BrCl2N2 |
| Molecular Weight | 332.03 g/mol |
| Exact Mass | 329.93 |
| IUPAC Name | 3-bromo-N-(3,5-dichlorophenyl)-4-methylpyridin-2-amine |
| SMILES | Cc1ccnc(Nc2cc(Cl)cc(Cl)c2)c1Br |
| InChI | InChI=1S/C12H9BrCl2N2/c1-7-2-3-16-12(11(7)13)17-10-5-8(14)4-9(15)6-10/h2-6H,1H3,(H,16,17) |
| InChIKey | ZTBGNFPQBURSDU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.03 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |