C12H6BrF5N2 — CID 106877354
3-bromo-4-methyl-N-(2,3,4,5,6-pentafluorophenyl)pyridin-2-amine (PubChem CID 106877354) has the molecular formula C12H6BrF5N2 and a molecular weight of 353.09 g/mol. Its IUPAC name is 3-bromo-4-methyl-N-(2,3,4,5,6-pentafluorophenyl)pyridin-2-amine.
| Compound Name | 3-bromo-4-methyl-N-(2,3,4,5,6-pentafluorophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 106877354 |
| Molecular Formula | C12H6BrF5N2 |
| Molecular Weight | 353.09 g/mol |
| Exact Mass | 351.96 |
| IUPAC Name | 3-bromo-4-methyl-N-(2,3,4,5,6-pentafluorophenyl)pyridin-2-amine |
| SMILES | Cc1ccnc(Nc2c(F)c(F)c(F)c(F)c2F)c1Br |
| InChI | InChI=1S/C12H6BrF5N2/c1-4-2-3-19-12(5(4)13)20-11-9(17)7(15)6(14)8(16)10(11)18/h2-3H,1H3,(H,19,20) |
| InChIKey | AKPYQHAEJWLHBU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.09 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|