C13H8BrN3O2 — CID 61374663
5-[(3-bromo-2-pyridinyl)amino]isoindole-1,3-dione (PubChem CID 61374663) has the molecular formula C13H8BrN3O2 and a molecular weight of 318.13 g/mol. Its IUPAC name is 5-[(3-bromo-2-pyridinyl)amino]isoindole-1,3-dione.
| Compound Name | 5-[(3-bromo-2-pyridinyl)amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 61374663 |
| Molecular Formula | C13H8BrN3O2 |
| Molecular Weight | 318.13 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | 5-[(3-bromo-2-pyridinyl)amino]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2cc(Nc3ncccc3Br)ccc21 |
| InChI | InChI=1S/C13H8BrN3O2/c14-10-2-1-5-15-11(10)16-7-3-4-8-9(6-7)13(19)17-12(8)18/h1-6H,(H,15,16)(H,17,18,19) |
| InChIKey | WNKBHLXPJJXFSW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.13 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|