C17H20ClN5O — CID 108776754
[4-[(2-chloro-6-methylpyrimidin-4-yl)amino]phenyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 108776754) has the molecular formula C17H20ClN5O and a molecular weight of 345.83 g/mol. Its IUPAC name is [4-[(2-chloro-6-methylpyrimidin-4-yl)amino]phenyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [4-[(2-chloro-6-methylpyrimidin-4-yl)amino]phenyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 108776754 |
| Molecular Formula | C17H20ClN5O |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | [4-[(2-chloro-6-methylpyrimidin-4-yl)amino]phenyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | Cc1cc(Nc2ccc(C(=O)N3CCN(C)CC3)cc2)nc(Cl)n1 |
| InChI | InChI=1S/C17H20ClN5O/c1-12-11-15(21-17(18)19-12)20-14-5-3-13(4-6-14)16(24)23-9-7-22(2)8-10-23/h3-6,11H,7-10H2,1-2H3,(H,19,20,21) |
| InChIKey | MYLDWQPQGUXWBL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |