C22H24ClN6OP — CID 145468385
[4-[[4-(3-chloro-4-phosphanylanilino)pyrimidin-2-yl]amino]phenyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 145468385) has the molecular formula C22H24ClN6OP and a molecular weight of 454.90 g/mol. Its IUPAC name is [4-[[4-(3-chloro-4-phosphanylanilino)pyrimidin-2-yl]amino]phenyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [4-[[4-(3-chloro-4-phosphanylanilino)pyrimidin-2-yl]amino]phenyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 145468385 |
| Molecular Formula | C22H24ClN6OP |
| Molecular Weight | 454.90 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | [4-[[4-(3-chloro-4-phosphanylanilino)pyrimidin-2-yl]amino]phenyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccc(Nc3nccc(Nc4ccc(P)c(Cl)c4)n3)cc2)CC1 |
| InChI | InChI=1S/C22H24ClN6OP/c1-28-10-12-29(13-11-28)21(30)15-2-4-16(5-3-15)26-22-24-9-8-20(27-22)25-17-6-7-19(31)18(23)14-17/h2-9,14H,10-13,31H2,1H3,(H2,24,25,26,27) |
| InChIKey | XYGACZMAYNPJJK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.90 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|