About 4-[(2,6-dimethylpyrimidin-4-yl)amino]benzoic acid;hydrochloride
4-[(2,6-dimethylpyrimidin-4-yl)amino]benzoic acid;hydrochloride (PubChem CID 16876771) has the molecular formula C13H14ClN3O2
and a molecular weight of 279.73 g/mol. Its IUPAC name is 4-[(2,6-dimethylpyrimidin-4-yl)amino]benzoic acid;hydrochloride.
Molecular Properties
| Compound Name | 4-[(2,6-dimethylpyrimidin-4-yl)amino]benzoic acid;hydrochloride |
| PubChem CID | 16876771 |
| Molecular Formula | C13H14ClN3O2 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 4-[(2,6-dimethylpyrimidin-4-yl)amino]benzoic acid;hydrochloride |
| SMILES | Cc1cc(Nc2ccc(C(=O)O)cc2)nc(C)n1.Cl |
| InChI | InChI=1S/C13H13N3O2.ClH/c1-8-7-12(15-9(2)14-8)16-11-5-3-10(4-6-11)13(17)18;/h3-7H,1-2H3,(H,17,18)(H,14,15,16);1H |
| InChIKey | RGSRXDZAIDTTOE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2,6-dimethylpyrimidin-4-yl)amino]benzoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,6-dimethylpyrimidin-4-yl)amino]benzoic acid;hydrochloride?
The IUPAC name of 4-[(2,6-dimethylpyrimidin-4-yl)amino]benzoic acid;hydrochloride (CID 16876771) is 4-[(2,6-dimethylpyrimidin-4-yl)amino]benzoic acid;hydrochloride.
What is the SMILES notation for 4-[(2,6-dimethylpyrimidin-4-yl)amino]benzoic acid;hydrochloride?
The canonical SMILES for 4-[(2,6-dimethylpyrimidin-4-yl)amino]benzoic acid;hydrochloride is Cc1cc(Nc2ccc(C(=O)O)cc2)nc(C)n1.Cl.
What is the InChIKey of 4-[(2,6-dimethylpyrimidin-4-yl)amino]benzoic acid;hydrochloride?
The InChIKey is RGSRXDZAIDTTOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O2.ClH/c1-8-7-12(15-9(2)14-8)16-11-5-3-10(4-6-11)13(17)18;/h3-7H,1-2H3,(H,17,18)(H,14,15,16);1H.
What are the key properties of 4-[(2,6-dimethylpyrimidin-4-yl)amino]benzoic acid;hydrochloride?
4-[(2,6-dimethylpyrimidin-4-yl)amino]benzoic acid;hydrochloride has a molecular weight of 279.73 g/mol, XLogP of 2.96, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,6-dimethylpyrimidin-4-yl)amino]benzoic acid;hydrochloride is sourced from PubChem (CID 16876771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).