C16H24N4O — CID 156868242
N-[4-[(2,6-dimethylpyrimidin-4-yl)amino]phenyl]acetamide;ethene;molecular hydrogen (PubChem CID 156868242) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is N-[4-[(2,6-dimethylpyrimidin-4-yl)amino]phenyl]acetamide;ethene;molecular hydrogen.
| Compound Name | N-[4-[(2,6-dimethylpyrimidin-4-yl)amino]phenyl]acetamide;ethene;molecular hydrogen |
|---|---|
| PubChem CID | 156868242 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | N-[4-[(2,6-dimethylpyrimidin-4-yl)amino]phenyl]acetamide;ethene;molecular hydrogen |
| SMILES | C=C.CC(=O)Nc1ccc(Nc2cc(C)nc(C)n2)cc1.[H][H].[H][H] |
| InChI | InChI=1S/C14H16N4O.C2H4.2H2/c1-9-8-14(16-10(2)15-9)18-13-6-4-12(5-7-13)17-11(3)19;1-2;;/h4-8H,1-3H3,(H,17,19)(H,15,16,18);1-2H2;2*1H |
| InChIKey | GOUGOOVOYVAVRE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|