C20H20N4O2 — CID 113193288
4-[[6-(4-ethylanilino)-2-methylpyrimidin-4-yl]amino]benzoic acid (PubChem CID 113193288) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 4-[[6-(4-ethylanilino)-2-methylpyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[6-(4-ethylanilino)-2-methylpyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 113193288 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 4-[[6-(4-ethylanilino)-2-methylpyrimidin-4-yl]amino]benzoic acid |
| SMILES | CCc1ccc(Nc2cc(Nc3ccc(C(=O)O)cc3)nc(C)n2)cc1 |
| InChI | InChI=1S/C20H20N4O2/c1-3-14-4-8-16(9-5-14)23-18-12-19(22-13(2)21-18)24-17-10-6-15(7-11-17)20(25)26/h4-12H,3H2,1-2H3,(H,25,26)(H2,21,22,23,24) |
| InChIKey | ZDCNLQCNHVTQBI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |