C21H22N4O2 — CID 112877592
methyl 4-[[6-(4-ethylanilino)-2-methylpyrimidin-4-yl]amino]benzoate (PubChem CID 112877592) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is methyl 4-[[6-(4-ethylanilino)-2-methylpyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 4-[[6-(4-ethylanilino)-2-methylpyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 112877592 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | methyl 4-[[6-(4-ethylanilino)-2-methylpyrimidin-4-yl]amino]benzoate |
| SMILES | CCc1ccc(Nc2cc(Nc3ccc(C(=O)OC)cc3)nc(C)n2)cc1 |
| InChI | InChI=1S/C21H22N4O2/c1-4-15-5-9-17(10-6-15)24-19-13-20(23-14(2)22-19)25-18-11-7-16(8-12-18)21(26)27-3/h5-13H,4H2,1-3H3,(H2,22,23,24,25) |
| InChIKey | CANLYHMGWOKPSW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |