C25H27N5O — CID 138647780
[4-(methylideneamino)phenyl]-[4-[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]piperidin-1-yl]methanone (PubChem CID 138647780) has the molecular formula C25H27N5O and a molecular weight of 413.53 g/mol. Its IUPAC name is [4-(methylideneamino)phenyl]-[4-[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]piperidin-1-yl]methanone.
| Compound Name | [4-(methylideneamino)phenyl]-[4-[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 138647780 |
| Molecular Formula | C25H27N5O |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | [4-(methylideneamino)phenyl]-[4-[4-methyl-6-(4-methylanilino)pyrimidin-2-yl]piperidin-1-yl]methanone |
| SMILES | C=Nc1ccc(C(=O)N2CCC(c3nc(C)cc(Nc4ccc(C)cc4)n3)CC2)cc1 |
| InChI | InChI=1S/C25H27N5O/c1-17-4-8-22(9-5-17)28-23-16-18(2)27-24(29-23)19-12-14-30(15-13-19)25(31)20-6-10-21(26-3)11-7-20/h4-11,16,19H,3,12-15H2,1-2H3,(H,27,28,29) |
| InChIKey | UXDQDXQBMOUCLO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|