About 2-methanimidoyl-4-N-(5-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine;molecular hydrogen
2-methanimidoyl-4-N-(5-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine;molecular hydrogen (PubChem CID 143370621) has the molecular formula C16H18N4S
and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-methanimidoyl-4-N-(5-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine;molecular hydrogen.
Molecular Properties
| Compound Name | 2-methanimidoyl-4-N-(5-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine;molecular hydrogen |
| PubChem CID | 143370621 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-methanimidoyl-4-N-(5-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine;molecular hydrogen |
| SMILES | [H]/N=C/c1cc(Nc2ncc(-c3ccccc3)s2)ccc1N.[H][H].[H][H] |
| InChI | InChI=1S/C16H14N4S.2H2/c17-9-12-8-13(6-7-14(12)18)20-16-19-10-15(21-16)11-4-2-1-3-5-11;;/h1-10,17H,18H2,(H,19,20);2*1H/b17-9+;; |
| InChIKey | UXEHWCHIEKQHIW-CECDQNOMSA-N |
| XLogP | 4.63 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methanimidoyl-4-N-(5-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanimidoyl-4-N-(5-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine;molecular hydrogen?
The IUPAC name of 2-methanimidoyl-4-N-(5-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine;molecular hydrogen (CID 143370621) is 2-methanimidoyl-4-N-(5-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine;molecular hydrogen.
What is the SMILES notation for 2-methanimidoyl-4-N-(5-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine;molecular hydrogen?
The canonical SMILES for 2-methanimidoyl-4-N-(5-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine;molecular hydrogen is [H]/N=C/c1cc(Nc2ncc(-c3ccccc3)s2)ccc1N.[H][H].[H][H].
What is the InChIKey of 2-methanimidoyl-4-N-(5-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine;molecular hydrogen?
The InChIKey is UXEHWCHIEKQHIW-CECDQNOMSA-N. The full InChI is InChI=1S/C16H14N4S.2H2/c17-9-12-8-13(6-7-14(12)18)20-16-19-10-15(21-16)11-4-2-1-3-5-11;;/h1-10,17H,18H2,(H,19,20);2*1H/b17-9+;;.
What are the key properties of 2-methanimidoyl-4-N-(5-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine;molecular hydrogen?
2-methanimidoyl-4-N-(5-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine;molecular hydrogen has a molecular weight of 298.41 g/mol, XLogP of 4.63, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanimidoyl-4-N-(5-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine;molecular hydrogen is sourced from PubChem (CID 143370621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).