C16H18N4S — CID 143370621
2-methanimidoyl-4-N-(5-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine;molecular hydrogen (PubChem CID 143370621) has the molecular formula C16H18N4S and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-methanimidoyl-4-N-(5-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine;molecular hydrogen.
| Compound Name | 2-methanimidoyl-4-N-(5-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine;molecular hydrogen |
|---|---|
| PubChem CID | 143370621 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-methanimidoyl-4-N-(5-phenyl-1,3-thiazol-2-yl)benzene-1,4-diamine;molecular hydrogen |
| SMILES | [H]/N=C/c1cc(Nc2ncc(-c3ccccc3)s2)ccc1N.[H][H].[H][H] |
| InChI | InChI=1S/C16H14N4S.2H2/c17-9-12-8-13(6-7-14(12)18)20-16-19-10-15(21-16)11-4-2-1-3-5-11;;/h1-10,17H,18H2,(H,19,20);2*1H/b17-9+;; |
| InChIKey | UXEHWCHIEKQHIW-CECDQNOMSA-N |
| XLogP | 4.63 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|