C21H15Cl2N5 — CID 142172419
4-N-[2-(2,4-dichlorophenyl)quinazolin-4-yl]-2-methanimidoylbenzene-1,4-diamine (PubChem CID 142172419) has the molecular formula C21H15Cl2N5 and a molecular weight of 408.29 g/mol. Its IUPAC name is 4-N-[2-(2,4-dichlorophenyl)quinazolin-4-yl]-2-methanimidoylbenzene-1,4-diamine.
| Compound Name | 4-N-[2-(2,4-dichlorophenyl)quinazolin-4-yl]-2-methanimidoylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 142172419 |
| Molecular Formula | C21H15Cl2N5 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 4-N-[2-(2,4-dichlorophenyl)quinazolin-4-yl]-2-methanimidoylbenzene-1,4-diamine |
| SMILES | [H]/N=C/c1cc(Nc2nc(-c3ccc(Cl)cc3Cl)nc3ccccc23)ccc1N |
| InChI | InChI=1S/C21H15Cl2N5/c22-13-5-7-15(17(23)10-13)20-27-19-4-2-1-3-16(19)21(28-20)26-14-6-8-18(25)12(9-14)11-24/h1-11,24H,25H2,(H,26,27,28)/b24-11+ |
| InChIKey | YJAHSPCRCIFZFF-BHGWPJFGSA-N |
| XLogP | 5.93 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|