C19H16Cl2N6 — CID 10126697
N'-[2-(2,4-dichlorophenyl)quinazolin-4-yl]-N-(1H-pyrazol-5-yl)ethane-1,2-diamine (PubChem CID 10126697) has the molecular formula C19H16Cl2N6 and a molecular weight of 399.29 g/mol. Its IUPAC name is N'-[2-(2,4-dichlorophenyl)quinazolin-4-yl]-N-(1H-pyrazol-5-yl)ethane-1,2-diamine.
| Compound Name | N'-[2-(2,4-dichlorophenyl)quinazolin-4-yl]-N-(1H-pyrazol-5-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 10126697 |
| Molecular Formula | C19H16Cl2N6 |
| Molecular Weight | 399.29 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | N'-[2-(2,4-dichlorophenyl)quinazolin-4-yl]-N-(1H-pyrazol-5-yl)ethane-1,2-diamine |
| SMILES | Clc1ccc(-c2nc(NCCNc3ccn[nH]3)c3ccccc3n2)c(Cl)c1 |
| InChI | InChI=1S/C19H16Cl2N6/c20-12-5-6-13(15(21)11-12)19-25-16-4-2-1-3-14(16)18(26-19)23-10-9-22-17-7-8-24-27-17/h1-8,11H,9-10H2,(H2,22,24,27)(H,23,25,26) |
| InChIKey | QRVZLAOHVZPXJQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.29 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|