C18H18ClN3 — CID 727473
2-(2-chlorophenyl)-N-(2-methylpropyl)quinazolin-4-amine (PubChem CID 727473) has the molecular formula C18H18ClN3 and a molecular weight of 311.82 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-(2-methylpropyl)quinazolin-4-amine.
| Compound Name | 2-(2-chlorophenyl)-N-(2-methylpropyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 727473 |
| Molecular Formula | C18H18ClN3 |
| Molecular Weight | 311.82 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-(2-chlorophenyl)-N-(2-methylpropyl)quinazolin-4-amine |
| SMILES | CC(C)CNc1nc(-c2ccccc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C18H18ClN3/c1-12(2)11-20-17-14-8-4-6-10-16(14)21-18(22-17)13-7-3-5-9-15(13)19/h3-10,12H,11H2,1-2H3,(H,20,21,22) |
| InChIKey | KGTBIDTZMFCMBK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.82 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |