About N-[3-chloro-4-[4-(2,2-diphenylethylamino)quinazolin-2-yl]phenyl]methanesulfonamide
N-[3-chloro-4-[4-(2,2-diphenylethylamino)quinazolin-2-yl]phenyl]methanesulfonamide (PubChem CID 121378083) has the molecular formula C29H25ClN4O2S
and a molecular weight of 529.07 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(2,2-diphenylethylamino)quinazolin-2-yl]phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[3-chloro-4-[4-(2,2-diphenylethylamino)quinazolin-2-yl]phenyl]methanesulfonamide |
| PubChem CID | 121378083 |
| Molecular Formula | C29H25ClN4O2S |
| Molecular Weight | 529.07 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | N-[3-chloro-4-[4-(2,2-diphenylethylamino)quinazolin-2-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(-c2nc(NCC(c3ccccc3)c3ccccc3)c3ccccc3n2)c(Cl)c1 |
| InChI | InChI=1S/C29H25ClN4O2S/c1-37(35,36)34-22-16-17-23(26(30)18-22)29-32-27-15-9-8-14-24(27)28(33-29)31-19-25(20-10-4-2-5-11-20)21-12-6-3-7-13-21/h2-18,25,34H,19H2,1H3,(H,31,32,33) |
| InChIKey | GAWFHEJTBODYDU-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 529.07 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[3-chloro-4-[4-(2,2-diphenylethylamino)quinazolin-2-yl]phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-chloro-4-[4-(2,2-diphenylethylamino)quinazolin-2-yl]phenyl]methanesulfonamide?
The IUPAC name of N-[3-chloro-4-[4-(2,2-diphenylethylamino)quinazolin-2-yl]phenyl]methanesulfonamide (CID 121378083) is N-[3-chloro-4-[4-(2,2-diphenylethylamino)quinazolin-2-yl]phenyl]methanesulfonamide.
What is the SMILES notation for N-[3-chloro-4-[4-(2,2-diphenylethylamino)quinazolin-2-yl]phenyl]methanesulfonamide?
The canonical SMILES for N-[3-chloro-4-[4-(2,2-diphenylethylamino)quinazolin-2-yl]phenyl]methanesulfonamide is CS(=O)(=O)Nc1ccc(-c2nc(NCC(c3ccccc3)c3ccccc3)c3ccccc3n2)c(Cl)c1.
What is the InChIKey of N-[3-chloro-4-[4-(2,2-diphenylethylamino)quinazolin-2-yl]phenyl]methanesulfonamide?
The InChIKey is GAWFHEJTBODYDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H25ClN4O2S/c1-37(35,36)34-22-16-17-23(26(30)18-22)29-32-27-15-9-8-14-24(27)28(33-29)31-19-25(20-10-4-2-5-11-20)21-12-6-3-7-13-21/h2-18,25,34H,19H2,1H3,(H,31,32,33).
What are the key properties of N-[3-chloro-4-[4-(2,2-diphenylethylamino)quinazolin-2-yl]phenyl]methanesulfonamide?
N-[3-chloro-4-[4-(2,2-diphenylethylamino)quinazolin-2-yl]phenyl]methanesulfonamide has a molecular weight of 529.07 g/mol, XLogP of 6.57, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-chloro-4-[4-(2,2-diphenylethylamino)quinazolin-2-yl]phenyl]methanesulfonamide is sourced from PubChem (CID 121378083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).