C29H25ClN4O2S — CID 121378083
N-[3-chloro-4-[4-(2,2-diphenylethylamino)quinazolin-2-yl]phenyl]methanesulfonamide (PubChem CID 121378083) has the molecular formula C29H25ClN4O2S and a molecular weight of 529.07 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(2,2-diphenylethylamino)quinazolin-2-yl]phenyl]methanesulfonamide.
| Compound Name | N-[3-chloro-4-[4-(2,2-diphenylethylamino)quinazolin-2-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 121378083 |
| Molecular Formula | C29H25ClN4O2S |
| Molecular Weight | 529.07 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | N-[3-chloro-4-[4-(2,2-diphenylethylamino)quinazolin-2-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(-c2nc(NCC(c3ccccc3)c3ccccc3)c3ccccc3n2)c(Cl)c1 |
| InChI | InChI=1S/C29H25ClN4O2S/c1-37(35,36)34-22-16-17-23(26(30)18-22)29-32-27-15-9-8-14-24(27)28(33-29)31-19-25(20-10-4-2-5-11-20)21-12-6-3-7-13-21/h2-18,25,34H,19H2,1H3,(H,31,32,33) |
| InChIKey | GAWFHEJTBODYDU-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.07 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |