C28H25N5O2S — CID 121378099
N-[4-[4-[(2-phenyl-2-pyridin-3-ylethyl)amino]quinazolin-2-yl]phenyl]methanesulfonamide (PubChem CID 121378099) has the molecular formula C28H25N5O2S and a molecular weight of 495.61 g/mol. Its IUPAC name is N-[4-[4-[(2-phenyl-2-pyridin-3-ylethyl)amino]quinazolin-2-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[4-[(2-phenyl-2-pyridin-3-ylethyl)amino]quinazolin-2-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 121378099 |
| Molecular Formula | C28H25N5O2S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | N-[4-[4-[(2-phenyl-2-pyridin-3-ylethyl)amino]quinazolin-2-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(-c2nc(NCC(c3ccccc3)c3cccnc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C28H25N5O2S/c1-36(34,35)33-23-15-13-21(14-16-23)27-31-26-12-6-5-11-24(26)28(32-27)30-19-25(20-8-3-2-4-9-20)22-10-7-17-29-18-22/h2-18,25,33H,19H2,1H3,(H,30,31,32) |
| InChIKey | BJDWTORJRALCQH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |