C27H24N6O2S — CID 121378089
N-[4-[4-[(2-phenyl-2-pyrimidin-2-ylethyl)amino]quinazolin-2-yl]phenyl]methanesulfonamide (PubChem CID 121378089) has the molecular formula C27H24N6O2S and a molecular weight of 496.60 g/mol. Its IUPAC name is N-[4-[4-[(2-phenyl-2-pyrimidin-2-ylethyl)amino]quinazolin-2-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[4-[(2-phenyl-2-pyrimidin-2-ylethyl)amino]quinazolin-2-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 121378089 |
| Molecular Formula | C27H24N6O2S |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | N-[4-[4-[(2-phenyl-2-pyrimidin-2-ylethyl)amino]quinazolin-2-yl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(-c2nc(NCC(c3ccccc3)c3ncccn3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C27H24N6O2S/c1-36(34,35)33-21-14-12-20(13-15-21)25-31-24-11-6-5-10-22(24)27(32-25)30-18-23(19-8-3-2-4-9-19)26-28-16-7-17-29-26/h2-17,23,33H,18H2,1H3,(H,30,31,32) |
| InChIKey | VBRVVFLLZWCYNP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |