C28H25N5 — CID 121377251
2-(2-amino-6-methyl-3-pyridinyl)-N-(2,2-diphenylethyl)quinazolin-4-amine (PubChem CID 121377251) has the molecular formula C28H25N5 and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-(2-amino-6-methyl-3-pyridinyl)-N-(2,2-diphenylethyl)quinazolin-4-amine.
| Compound Name | 2-(2-amino-6-methyl-3-pyridinyl)-N-(2,2-diphenylethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 121377251 |
| Molecular Formula | C28H25N5 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 2-(2-amino-6-methyl-3-pyridinyl)-N-(2,2-diphenylethyl)quinazolin-4-amine |
| SMILES | Cc1ccc(-c2nc(NCC(c3ccccc3)c3ccccc3)c3ccccc3n2)c(N)n1 |
| InChI | InChI=1S/C28H25N5/c1-19-16-17-23(26(29)31-19)28-32-25-15-9-8-14-22(25)27(33-28)30-18-24(20-10-4-2-5-11-20)21-12-6-3-7-13-21/h2-17,24H,18H2,1H3,(H2,29,31)(H,30,32,33) |
| InChIKey | WBSXXMVQKXZHNB-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |