C19H17Cl2N5O — CID 142253434
(Z)-N'-[2-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]ethyl]-3-hydroxyprop-2-enimidamide (PubChem CID 142253434) has the molecular formula C19H17Cl2N5O and a molecular weight of 402.29 g/mol. Its IUPAC name is (Z)-N'-[2-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]ethyl]-3-hydroxyprop-2-enimidamide.
| Compound Name | (Z)-N'-[2-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]ethyl]-3-hydroxyprop-2-enimidamide |
|---|---|
| PubChem CID | 142253434 |
| Molecular Formula | C19H17Cl2N5O |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | (Z)-N'-[2-[[2-(2,4-dichlorophenyl)quinazolin-4-yl]amino]ethyl]-3-hydroxyprop-2-enimidamide |
| SMILES | NC(/C=C\O)=N\CCNc1nc(-c2ccc(Cl)cc2Cl)nc2ccccc12 |
| InChI | InChI=1S/C19H17Cl2N5O/c20-12-5-6-13(15(21)11-12)19-25-16-4-2-1-3-14(16)18(26-19)24-9-8-23-17(22)7-10-27/h1-7,10-11,27H,8-9H2,(H2,22,23)(H,24,25,26)/b10-7- |
| InChIKey | IOYOTXQTEMJRHP-YFHOEESVSA-N |
| XLogP | 4.44 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|