C21H14Cl2N4 — CID 5160943
2-(2-chlorophenyl)-N-[(4-chlorophenyl)methylideneamino]quinazolin-4-amine (PubChem CID 5160943) has the molecular formula C21H14Cl2N4 and a molecular weight of 393.28 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[(4-chlorophenyl)methylideneamino]quinazolin-4-amine.
| Compound Name | 2-(2-chlorophenyl)-N-[(4-chlorophenyl)methylideneamino]quinazolin-4-amine |
|---|---|
| PubChem CID | 5160943 |
| Molecular Formula | C21H14Cl2N4 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[(4-chlorophenyl)methylideneamino]quinazolin-4-amine |
| SMILES | Clc1ccc(C=NNc2nc(-c3ccccc3Cl)nc3ccccc23)cc1 |
| InChI | InChI=1S/C21H14Cl2N4/c22-15-11-9-14(10-12-15)13-24-27-21-17-6-2-4-8-19(17)25-20(26-21)16-5-1-3-7-18(16)23/h1-13H,(H,25,26,27) |
| InChIKey | MKBYDBHGRQPQGO-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|