C22H17ClN4O2 — CID 135549541
4-[(E)-[[2-(4-chlorophenyl)quinazolin-4-yl]hydrazinylidene]methyl]-2-methoxyphenol (PubChem CID 135549541) has the molecular formula C22H17ClN4O2 and a molecular weight of 404.86 g/mol. Its IUPAC name is 4-[(E)-[[2-(4-chlorophenyl)quinazolin-4-yl]hydrazinylidene]methyl]-2-methoxyphenol.
| Compound Name | 4-[(E)-[[2-(4-chlorophenyl)quinazolin-4-yl]hydrazinylidene]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 135549541 |
| Molecular Formula | C22H17ClN4O2 |
| Molecular Weight | 404.86 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 4-[(E)-[[2-(4-chlorophenyl)quinazolin-4-yl]hydrazinylidene]methyl]-2-methoxyphenol |
| SMILES | COc1cc(/C=N/Nc2nc(-c3ccc(Cl)cc3)nc3ccccc23)ccc1O |
| InChI | InChI=1S/C22H17ClN4O2/c1-29-20-12-14(6-11-19(20)28)13-24-27-22-17-4-2-3-5-18(17)25-21(26-22)15-7-9-16(23)10-8-15/h2-13,28H,1H3,(H,25,26,27)/b24-13+ |
| InChIKey | XZBIOPVNVJMAPM-ZMOGYAJESA-N |
| XLogP | 5.11 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.86 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|