C18H14ClN7O3 — CID 135536213
4-[(E)-[[6-(4-chloroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]-2-methoxyphenol (PubChem CID 135536213) has the molecular formula C18H14ClN7O3 and a molecular weight of 411.81 g/mol. Its IUPAC name is 4-[(E)-[[6-(4-chloroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]-2-methoxyphenol.
| Compound Name | 4-[(E)-[[6-(4-chloroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 135536213 |
| Molecular Formula | C18H14ClN7O3 |
| Molecular Weight | 411.81 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 4-[(E)-[[6-(4-chloroanilino)-[1,2,5]oxadiazolo[3,4-b]pyrazin-5-yl]hydrazinylidene]methyl]-2-methoxyphenol |
| SMILES | COc1cc(/C=N/Nc2nc3nonc3nc2Nc2ccc(Cl)cc2)ccc1O |
| InChI | InChI=1S/C18H14ClN7O3/c1-28-14-8-10(2-7-13(14)27)9-20-24-16-15(21-12-5-3-11(19)4-6-12)22-17-18(23-16)26-29-25-17/h2-9,27H,1H3,(H,21,22,25)(H,23,24,26)/b20-9+ |
| InChIKey | RJMNZLSYAPNFGJ-AWQFTUOYSA-N |
| XLogP | 3.57 |
| TPSA | 130.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.81 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|