C22H15ClN8O5 — CID 3098966
6-N-(4-chlorophenyl)-5-N-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine (PubChem CID 3098966) has the molecular formula C22H15ClN8O5 and a molecular weight of 506.87 g/mol. Its IUPAC name is 6-N-(4-chlorophenyl)-5-N-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine.
| Compound Name | 6-N-(4-chlorophenyl)-5-N-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
|---|---|
| PubChem CID | 3098966 |
| Molecular Formula | C22H15ClN8O5 |
| Molecular Weight | 506.87 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | 6-N-(4-chlorophenyl)-5-N-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccc(C=NNc2nc3nonc3nc2Nc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C22H15ClN8O5/c1-34-18-10-14(31(32)33)6-8-16(18)17-9-7-15(35-17)11-24-28-20-19(25-13-4-2-12(23)3-5-13)26-21-22(27-20)30-36-29-21/h2-11H,1H3,(H,25,26,29)(H,27,28,30) |
| InChIKey | YWMRDHWNSBCUMC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 166.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.87 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|