C23H17FN8O4 — CID 3101473
5-N-[[5-(2,5-dimethyl-3-nitrophenyl)furan-2-yl]methylideneamino]-6-N-(4-fluorophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine (PubChem CID 3101473) has the molecular formula C23H17FN8O4 and a molecular weight of 488.44 g/mol. Its IUPAC name is 5-N-[[5-(2,5-dimethyl-3-nitrophenyl)furan-2-yl]methylideneamino]-6-N-(4-fluorophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine.
| Compound Name | 5-N-[[5-(2,5-dimethyl-3-nitrophenyl)furan-2-yl]methylideneamino]-6-N-(4-fluorophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
|---|---|
| PubChem CID | 3101473 |
| Molecular Formula | C23H17FN8O4 |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 5-N-[[5-(2,5-dimethyl-3-nitrophenyl)furan-2-yl]methylideneamino]-6-N-(4-fluorophenyl)-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
| SMILES | Cc1cc(-c2ccc(C=NNc3nc4nonc4nc3Nc3ccc(F)cc3)o2)c(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H17FN8O4/c1-12-9-17(13(2)18(10-12)32(33)34)19-8-7-16(35-19)11-25-29-21-20(26-15-5-3-14(24)4-6-15)27-22-23(28-21)31-36-30-22/h3-11H,1-2H3,(H,26,27,30)(H,28,29,31) |
| InChIKey | MUZWROJHURGPKE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 157.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|