C17H9F4N7O3 — CID 134094302
6-N-(4-fluorophenyl)-5-N-[3-nitro-5-(trifluoromethyl)phenyl]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine (PubChem CID 134094302) has the molecular formula C17H9F4N7O3 and a molecular weight of 435.30 g/mol. Its IUPAC name is 6-N-(4-fluorophenyl)-5-N-[3-nitro-5-(trifluoromethyl)phenyl]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine.
| Compound Name | 6-N-(4-fluorophenyl)-5-N-[3-nitro-5-(trifluoromethyl)phenyl]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
|---|---|
| PubChem CID | 134094302 |
| Molecular Formula | C17H9F4N7O3 |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 6-N-(4-fluorophenyl)-5-N-[3-nitro-5-(trifluoromethyl)phenyl]-[1,2,5]oxadiazolo[3,4-b]pyrazine-5,6-diamine |
| SMILES | O=[N+]([O-])c1cc(Nc2nc3nonc3nc2Nc2ccc(F)cc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H9F4N7O3/c18-9-1-3-10(4-2-9)22-13-14(25-16-15(24-13)26-31-27-16)23-11-5-8(17(19,20)21)6-12(7-11)28(29)30/h1-7H,(H,22,24,26)(H,23,25,27) |
| InChIKey | JAROXBOZXRDMCL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|