C20H13F4N5O2 — CID 122578371
6-(6-fluoro-2-methylimidazo[1,2-a]pyridin-3-yl)-4-nitro-N-[4-(trifluoromethyl)phenyl]pyridin-2-amine (PubChem CID 122578371) has the molecular formula C20H13F4N5O2 and a molecular weight of 431.35 g/mol. Its IUPAC name is 6-(6-fluoro-2-methylimidazo[1,2-a]pyridin-3-yl)-4-nitro-N-[4-(trifluoromethyl)phenyl]pyridin-2-amine.
| Compound Name | 6-(6-fluoro-2-methylimidazo[1,2-a]pyridin-3-yl)-4-nitro-N-[4-(trifluoromethyl)phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 122578371 |
| Molecular Formula | C20H13F4N5O2 |
| Molecular Weight | 431.35 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 6-(6-fluoro-2-methylimidazo[1,2-a]pyridin-3-yl)-4-nitro-N-[4-(trifluoromethyl)phenyl]pyridin-2-amine |
| SMILES | Cc1nc2ccc(F)cn2c1-c1cc([N+](=O)[O-])cc(Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C20H13F4N5O2/c1-11-19(28-10-13(21)4-7-18(28)25-11)16-8-15(29(30)31)9-17(27-16)26-14-5-2-12(3-6-14)20(22,23)24/h2-10H,1H3,(H,26,27) |
| InChIKey | BYYODZRNZYWZRC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.35 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|