C12H5F3N8O3 — CID 73253787
N-[3-nitro-5-(trifluoromethyl)phenyl]-4-oxa-1,3,5,7,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-8-amine (PubChem CID 73253787) has the molecular formula C12H5F3N8O3 and a molecular weight of 366.22 g/mol. Its IUPAC name is N-[3-nitro-5-(trifluoromethyl)phenyl]-4-oxa-1,3,5,7,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-8-amine.
| Compound Name | N-[3-nitro-5-(trifluoromethyl)phenyl]-4-oxa-1,3,5,7,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-8-amine |
|---|---|
| PubChem CID | 73253787 |
| Molecular Formula | C12H5F3N8O3 |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | N-[3-nitro-5-(trifluoromethyl)phenyl]-4-oxa-1,3,5,7,10,11-hexazatricyclo[7.3.0.02,6]dodeca-2,5,7,9,11-pentaen-8-amine |
| SMILES | O=[N+]([O-])c1cc(Nc2nc3nonc3n3cnnc23)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H5F3N8O3/c13-12(14,15)5-1-6(3-7(2-5)23(24)25)17-8-10-19-16-4-22(10)11-9(18-8)20-26-21-11/h1-4H,(H,17,18,20) |
| InChIKey | XEUZHXOYQQNGDT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 137.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|