C15H13F3N2O3 — CID 177043790
(3Z)-3-ethenyl-N-[3-nitro-5-(trifluoromethyl)phenyl]hexa-3,5-dienamide (PubChem CID 177043790) has the molecular formula C15H13F3N2O3 and a molecular weight of 326.27 g/mol. Its IUPAC name is (3Z)-3-ethenyl-N-[3-nitro-5-(trifluoromethyl)phenyl]hexa-3,5-dienamide.
| Compound Name | (3Z)-3-ethenyl-N-[3-nitro-5-(trifluoromethyl)phenyl]hexa-3,5-dienamide |
|---|---|
| PubChem CID | 177043790 |
| Molecular Formula | C15H13F3N2O3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | (3Z)-3-ethenyl-N-[3-nitro-5-(trifluoromethyl)phenyl]hexa-3,5-dienamide |
| SMILES | C=C/C=C(\C=C)CC(=O)Nc1cc([N+](=O)[O-])cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H13F3N2O3/c1-3-5-10(4-2)6-14(21)19-12-7-11(15(16,17)18)8-13(9-12)20(22)23/h3-5,7-9H,1-2,6H2,(H,19,21)/b10-5+ |
| InChIKey | AKWJVLQGCOAWNC-BJMVGYQFSA-N |
| XLogP | 4.24 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|