C18H19F3N4O3 — CID 120605377
N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-4-(4-nitroanilino)butanamide (PubChem CID 120605377) has the molecular formula C18H19F3N4O3 and a molecular weight of 396.37 g/mol. Its IUPAC name is N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-4-(4-nitroanilino)butanamide.
| Compound Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-4-(4-nitroanilino)butanamide |
|---|---|
| PubChem CID | 120605377 |
| Molecular Formula | C18H19F3N4O3 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-4-(4-nitroanilino)butanamide |
| SMILES | NCc1cc(NC(=O)CCCNc2ccc([N+](=O)[O-])cc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H19F3N4O3/c19-18(20,21)13-8-12(11-22)9-15(10-13)24-17(26)2-1-7-23-14-3-5-16(6-4-14)25(27)28/h3-6,8-10,23H,1-2,7,11,22H2,(H,24,26) |
| InChIKey | WHXUAKUXZFZSMH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|