C16H22ClF3N4O3 — CID 120605296
N-(2-acetamidoethyl)-N'-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]butanediamide;hydrochloride (PubChem CID 120605296) has the molecular formula C16H22ClF3N4O3 and a molecular weight of 410.82 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-N'-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]butanediamide;hydrochloride.
| Compound Name | N-(2-acetamidoethyl)-N'-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]butanediamide;hydrochloride |
|---|---|
| PubChem CID | 120605296 |
| Molecular Formula | C16H22ClF3N4O3 |
| Molecular Weight | 410.82 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-(2-acetamidoethyl)-N'-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]butanediamide;hydrochloride |
| SMILES | CC(=O)NCCNC(=O)CCC(=O)Nc1cc(CN)cc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C16H21F3N4O3.ClH/c1-10(24)21-4-5-22-14(25)2-3-15(26)23-13-7-11(9-20)6-12(8-13)16(17,18)19;/h6-8H,2-5,9,20H2,1H3,(H,21,24)(H,22,25)(H,23,26);1H |
| InChIKey | JICZGINXUNSUES-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.82 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|