C13H15F3N2O — CID 120604945
N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]pent-4-enamide (PubChem CID 120604945) has the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. Its IUPAC name is N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]pent-4-enamide.
| Compound Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]pent-4-enamide |
|---|---|
| PubChem CID | 120604945 |
| Molecular Formula | C13H15F3N2O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]pent-4-enamide |
| SMILES | C=CCCC(=O)Nc1cc(CN)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3N2O/c1-2-3-4-12(19)18-11-6-9(8-17)5-10(7-11)13(14,15)16/h2,5-7H,1,3-4,8,17H2,(H,18,19) |
| InChIKey | YVLJQPQSLCJLLM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|