C17H25F3N4O — CID 120605625
N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-3-(4-ethylpiperazin-1-yl)propanamide (PubChem CID 120605625) has the molecular formula C17H25F3N4O and a molecular weight of 358.41 g/mol. Its IUPAC name is N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-3-(4-ethylpiperazin-1-yl)propanamide.
| Compound Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-3-(4-ethylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 120605625 |
| Molecular Formula | C17H25F3N4O |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-3-(4-ethylpiperazin-1-yl)propanamide |
| SMILES | CCN1CCN(CCC(=O)Nc2cc(CN)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H25F3N4O/c1-2-23-5-7-24(8-6-23)4-3-16(25)22-15-10-13(12-21)9-14(11-15)17(18,19)20/h9-11H,2-8,12,21H2,1H3,(H,22,25) |
| InChIKey | SRAKPCYSTPNCOX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |