C18H18F4N2O2 — CID 120605051
N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-4-(2-fluorophenoxy)butanamide (PubChem CID 120605051) has the molecular formula C18H18F4N2O2 and a molecular weight of 370.35 g/mol. Its IUPAC name is N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-4-(2-fluorophenoxy)butanamide.
| Compound Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-4-(2-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 120605051 |
| Molecular Formula | C18H18F4N2O2 |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-[3-(aminomethyl)-5-(trifluoromethyl)phenyl]-4-(2-fluorophenoxy)butanamide |
| SMILES | NCc1cc(NC(=O)CCCOc2ccccc2F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H18F4N2O2/c19-15-4-1-2-5-16(15)26-7-3-6-17(25)24-14-9-12(11-23)8-13(10-14)18(20,21)22/h1-2,4-5,8-10H,3,6-7,11,23H2,(H,24,25) |
| InChIKey | JDIVWULXHSFJHE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|