C20H16F6N4O5 — CID 3547370
5-[2-[3,5-bis(trifluoromethyl)benzoyl]hydrazinyl]-N-(4-nitrophenyl)-5-oxopentanamide (PubChem CID 3547370) has the molecular formula C20H16F6N4O5 and a molecular weight of 506.36 g/mol. Its IUPAC name is 5-[2-[3,5-bis(trifluoromethyl)benzoyl]hydrazinyl]-N-(4-nitrophenyl)-5-oxopentanamide.
| Compound Name | 5-[2-[3,5-bis(trifluoromethyl)benzoyl]hydrazinyl]-N-(4-nitrophenyl)-5-oxopentanamide |
|---|---|
| PubChem CID | 3547370 |
| Molecular Formula | C20H16F6N4O5 |
| Molecular Weight | 506.36 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 5-[2-[3,5-bis(trifluoromethyl)benzoyl]hydrazinyl]-N-(4-nitrophenyl)-5-oxopentanamide |
| SMILES | O=C(CCCC(=O)Nc1ccc([N+](=O)[O-])cc1)NNC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H16F6N4O5/c21-19(22,23)12-8-11(9-13(10-12)20(24,25)26)18(33)29-28-17(32)3-1-2-16(31)27-14-4-6-15(7-5-14)30(34)35/h4-10H,1-3H2,(H,27,31)(H,28,32)(H,29,33) |
| InChIKey | FOJRZDSIBUKPSA-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|