C15H11F3N4O5 — CID 27678295
4-nitro-N'-[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]benzohydrazide (PubChem CID 27678295) has the molecular formula C15H11F3N4O5 and a molecular weight of 384.27 g/mol. Its IUPAC name is 4-nitro-N'-[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]benzohydrazide.
| Compound Name | 4-nitro-N'-[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 27678295 |
| Molecular Formula | C15H11F3N4O5 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 4-nitro-N'-[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]benzohydrazide |
| SMILES | O=C(Cn1cc(C(F)(F)F)ccc1=O)NNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H11F3N4O5/c16-15(17,18)10-3-6-13(24)21(7-10)8-12(23)19-20-14(25)9-1-4-11(5-2-9)22(26)27/h1-7H,8H2,(H,19,23)(H,20,25) |
| InChIKey | GNMKQUBPXBKJNF-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 123.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|