C17H16F3N3O5 — CID 7467801
2-(5-nitro-2-oxo-1-pyridinyl)-N-[2-propoxy-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 7467801) has the molecular formula C17H16F3N3O5 and a molecular weight of 399.33 g/mol. Its IUPAC name is 2-(5-nitro-2-oxo-1-pyridinyl)-N-[2-propoxy-5-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(5-nitro-2-oxo-1-pyridinyl)-N-[2-propoxy-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 7467801 |
| Molecular Formula | C17H16F3N3O5 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 2-(5-nitro-2-oxo-1-pyridinyl)-N-[2-propoxy-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCCOc1ccc(C(F)(F)F)cc1NC(=O)Cn1cc([N+](=O)[O-])ccc1=O |
| InChI | InChI=1S/C17H16F3N3O5/c1-2-7-28-14-5-3-11(17(18,19)20)8-13(14)21-15(24)10-22-9-12(23(26)27)4-6-16(22)25/h3-6,8-9H,2,7,10H2,1H3,(H,21,24) |
| InChIKey | LVMYSLUOPPIFEX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|