C18H17F3N2O4S — CID 30725586
2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-N-(2-propoxyphenyl)acetamide (PubChem CID 30725586) has the molecular formula C18H17F3N2O4S and a molecular weight of 414.41 g/mol. Its IUPAC name is 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-N-(2-propoxyphenyl)acetamide.
| Compound Name | 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-N-(2-propoxyphenyl)acetamide |
|---|---|
| PubChem CID | 30725586 |
| Molecular Formula | C18H17F3N2O4S |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-N-(2-propoxyphenyl)acetamide |
| SMILES | CCCOc1ccccc1NC(=O)CSc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H17F3N2O4S/c1-2-9-27-15-6-4-3-5-13(15)22-17(24)11-28-16-8-7-12(18(19,20)21)10-14(16)23(25)26/h3-8,10H,2,9,11H2,1H3,(H,22,24) |
| InChIKey | YAPNOXFHYISKGH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|