C18H14F3N3O4 — CID 102603809
3-methyl-N'-[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]-1-benzofuran-2-carbohydrazide (PubChem CID 102603809) has the molecular formula C18H14F3N3O4 and a molecular weight of 393.32 g/mol. Its IUPAC name is 3-methyl-N'-[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]-1-benzofuran-2-carbohydrazide.
| Compound Name | 3-methyl-N'-[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 102603809 |
| Molecular Formula | C18H14F3N3O4 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 3-methyl-N'-[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetyl]-1-benzofuran-2-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)Cn2cc(C(F)(F)F)ccc2=O)oc2ccccc12 |
| InChI | InChI=1S/C18H14F3N3O4/c1-10-12-4-2-3-5-13(12)28-16(10)17(27)23-22-14(25)9-24-8-11(18(19,20)21)6-7-15(24)26/h2-8H,9H2,1H3,(H,22,25)(H,23,27) |
| InChIKey | JDGSKDYDYOVJKR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|