C19H17F3N2O2 — CID 8911906
N-[2-(dimethylamino)-5-(trifluoromethyl)phenyl]-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 8911906) has the molecular formula C19H17F3N2O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is N-[2-(dimethylamino)-5-(trifluoromethyl)phenyl]-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-(dimethylamino)-5-(trifluoromethyl)phenyl]-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 8911906 |
| Molecular Formula | C19H17F3N2O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-[2-(dimethylamino)-5-(trifluoromethyl)phenyl]-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cc(C(F)(F)F)ccc2N(C)C)oc2ccccc12 |
| InChI | InChI=1S/C19H17F3N2O2/c1-11-13-6-4-5-7-16(13)26-17(11)18(25)23-14-10-12(19(20,21)22)8-9-15(14)24(2)3/h4-10H,1-3H3,(H,23,25) |
| InChIKey | PKQPPRJTSACMMZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |